C22H27NO2 — CID 140896299
4-tert-butyl-N-(3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)benzamide (PubChem CID 140896299) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 4-tert-butyl-N-(3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)benzamide.
| Compound Name | 4-tert-butyl-N-(3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)benzamide |
|---|---|
| PubChem CID | 140896299 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 4-tert-butyl-N-(3-hydroxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl)benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2cc3c(cc2O)CCCCC3)cc1 |
| InChI | InChI=1S/C22H27NO2/c1-22(2,3)18-11-9-15(10-12-18)21(25)23-19-13-16-7-5-4-6-8-17(16)14-20(19)24/h9-14,24H,4-8H2,1-3H3,(H,23,25) |
| InChIKey | NFFGSYGLXBWSQG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|