C25H19NO2 — CID 140896420
[3-(2,5-diphenylfuran-3-yl)-1H-indol-5-yl]methanol (PubChem CID 140896420) has the molecular formula C25H19NO2 and a molecular weight of 365.43 g/mol. Its IUPAC name is [3-(2,5-diphenylfuran-3-yl)-1H-indol-5-yl]methanol.
| Compound Name | [3-(2,5-diphenylfuran-3-yl)-1H-indol-5-yl]methanol |
|---|---|
| PubChem CID | 140896420 |
| Molecular Formula | C25H19NO2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [3-(2,5-diphenylfuran-3-yl)-1H-indol-5-yl]methanol |
| SMILES | OCc1ccc2[nH]cc(-c3cc(-c4ccccc4)oc3-c3ccccc3)c2c1 |
| InChI | InChI=1S/C25H19NO2/c27-16-17-11-12-23-20(13-17)22(15-26-23)21-14-24(18-7-3-1-4-8-18)28-25(21)19-9-5-2-6-10-19/h1-15,26-27H,16H2 |
| InChIKey | XBSTWHFFEAJOIN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 49.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |