C21H25BrN2O5S — CID 140896940
(5Z)-5-[[2-bromo-4-hydroxy-5-[[1-(2-methylpropanoyl)piperidin-4-yl]methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 140896940) has the molecular formula C21H25BrN2O5S and a molecular weight of 497.41 g/mol. Its IUPAC name is (5Z)-5-[[2-bromo-4-hydroxy-5-[[1-(2-methylpropanoyl)piperidin-4-yl]methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[[1-(2-methylpropanoyl)piperidin-4-yl]methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 140896940 |
| Molecular Formula | C21H25BrN2O5S |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 496.07 |
| IUPAC Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[[1-(2-methylpropanoyl)piperidin-4-yl]methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)C(=O)N1CCC(COc2cc(/C=C3\SC(=O)N(C)C3=O)c(Br)cc2O)CC1 |
| InChI | InChI=1S/C21H25BrN2O5S/c1-12(2)19(26)24-6-4-13(5-7-24)11-29-17-8-14(15(22)10-16(17)25)9-18-20(27)23(3)21(28)30-18/h8-10,12-13,25H,4-7,11H2,1-3H3/b18-9- |
| InChIKey | GURAFZGTBDTXAS-NVMNQCDNSA-N |
| XLogP | 4.09 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|