C16H12BrN3O5S — CID 140897169
(5Z)-5-[[2-bromo-4-hydroxy-5-[(6-oxo-1H-pyrimidin-5-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 140897169) has the molecular formula C16H12BrN3O5S and a molecular weight of 438.26 g/mol. Its IUPAC name is (5Z)-5-[[2-bromo-4-hydroxy-5-[(6-oxo-1H-pyrimidin-5-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[(6-oxo-1H-pyrimidin-5-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 140897169 |
| Molecular Formula | C16H12BrN3O5S |
| Molecular Weight | 438.26 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[(6-oxo-1H-pyrimidin-5-yl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)S/C(=C\c2cc(OCc3cnc[nH]c3=O)c(O)cc2Br)C1=O |
| InChI | InChI=1S/C16H12BrN3O5S/c1-20-15(23)13(26-16(20)24)3-8-2-12(11(21)4-10(8)17)25-6-9-5-18-7-19-14(9)22/h2-5,7,21H,6H2,1H3,(H,18,19,22)/b13-3- |
| InChIKey | BPADAFHDXLLOEP-DXNYSGJVSA-N |
| XLogP | 2.48 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|