C16H11BrN2O5S — CID 140897194
(5Z)-5-[[2-bromo-4-hydroxy-5-[(6-oxo-1H-pyridin-3-yl)oxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 140897194) has the molecular formula C16H11BrN2O5S and a molecular weight of 423.24 g/mol. Its IUPAC name is (5Z)-5-[[2-bromo-4-hydroxy-5-[(6-oxo-1H-pyridin-3-yl)oxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[(6-oxo-1H-pyridin-3-yl)oxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 140897194 |
| Molecular Formula | C16H11BrN2O5S |
| Molecular Weight | 423.24 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[(6-oxo-1H-pyridin-3-yl)oxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CN1C(=O)S/C(=C\c2cc(Oc3ccc(=O)[nH]c3)c(O)cc2Br)C1=O |
| InChI | InChI=1S/C16H11BrN2O5S/c1-19-15(22)13(25-16(19)23)5-8-4-12(11(20)6-10(8)17)24-9-2-3-14(21)18-7-9/h2-7,20H,1H3,(H,18,21)/b13-5- |
| InChIKey | CRDAKFYOOAMMCB-ACAGNQJTSA-N |
| XLogP | 3.30 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|