C16H10Br2N2 — CID 14089893
2,5-bis(4-bromophenyl)pyrimidine (PubChem CID 14089893) has the molecular formula C16H10Br2N2 and a molecular weight of 390.08 g/mol. Its IUPAC name is 2,5-bis(4-bromophenyl)pyrimidine.
| Compound Name | 2,5-bis(4-bromophenyl)pyrimidine |
|---|---|
| PubChem CID | 14089893 |
| Molecular Formula | C16H10Br2N2 |
| Molecular Weight | 390.08 g/mol |
| Exact Mass | 387.92 |
| IUPAC Name | 2,5-bis(4-bromophenyl)pyrimidine |
| SMILES | Brc1ccc(-c2cnc(-c3ccc(Br)cc3)nc2)cc1 |
| InChI | InChI=1S/C16H10Br2N2/c17-14-5-1-11(2-6-14)13-9-19-16(20-10-13)12-3-7-15(18)8-4-12/h1-10H |
| InChIKey | CWNWIRGWIJDSSR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.08 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |