C16H31NO2 — CID 140899931
2,2-dimethyl-N-[(4S)-2,2,6-trimethyl-3-oxooctan-4-yl]propanamide (PubChem CID 140899931) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is 2,2-dimethyl-N-[(4S)-2,2,6-trimethyl-3-oxooctan-4-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[(4S)-2,2,6-trimethyl-3-oxooctan-4-yl]propanamide |
|---|---|
| PubChem CID | 140899931 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | 2,2-dimethyl-N-[(4S)-2,2,6-trimethyl-3-oxooctan-4-yl]propanamide |
| SMILES | CCC(C)C[C@H](NC(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H31NO2/c1-9-11(2)10-12(13(18)15(3,4)5)17-14(19)16(6,7)8/h11-12H,9-10H2,1-8H3,(H,17,19)/t11?,12-/m0/s1 |
| InChIKey | YYFWYZZUBJNJFC-KIYNQFGBSA-N |
| XLogP | 3.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |