About 2,3-dihydropyrrole-1-carboximidamide;hydrochloride
2,3-dihydropyrrole-1-carboximidamide;hydrochloride (PubChem CID 140900060) has the molecular formula C5H10ClN3
and a molecular weight of 147.61 g/mol. Its IUPAC name is 2,3-dihydropyrrole-1-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | 2,3-dihydropyrrole-1-carboximidamide;hydrochloride |
| PubChem CID | 140900060 |
| Molecular Formula | C5H10ClN3 |
| Molecular Weight | 147.61 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | 2,3-dihydropyrrole-1-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1C=CCC1 |
| InChI | InChI=1S/C5H9N3.ClH/c6-5(7)8-3-1-2-4-8;/h1,3H,2,4H2,(H3,6,7);1H |
| InChIKey | ZWKASKZQZQUBOM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.61 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydropyrrole-1-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydropyrrole-1-carboximidamide;hydrochloride?
The IUPAC name of 2,3-dihydropyrrole-1-carboximidamide;hydrochloride (CID 140900060) is 2,3-dihydropyrrole-1-carboximidamide;hydrochloride.
What is the SMILES notation for 2,3-dihydropyrrole-1-carboximidamide;hydrochloride?
The canonical SMILES for 2,3-dihydropyrrole-1-carboximidamide;hydrochloride is Cl.[H]/N=C(\N)N1C=CCC1.
What is the InChIKey of 2,3-dihydropyrrole-1-carboximidamide;hydrochloride?
The InChIKey is ZWKASKZQZQUBOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3.ClH/c6-5(7)8-3-1-2-4-8;/h1,3H,2,4H2,(H3,6,7);1H.
What are the key properties of 2,3-dihydropyrrole-1-carboximidamide;hydrochloride?
2,3-dihydropyrrole-1-carboximidamide;hydrochloride has a molecular weight of 147.61 g/mol, XLogP of 0.52, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydropyrrole-1-carboximidamide;hydrochloride is sourced from PubChem (CID 140900060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).