About [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane
[(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane (PubChem CID 140900137) has the molecular formula C16H30Si
and a molecular weight of 250.50 g/mol. Its IUPAC name is [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane.
Molecular Properties
| Compound Name | [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane |
| PubChem CID | 140900137 |
| Molecular Formula | C16H30Si |
| Molecular Weight | 250.50 g/mol |
| Exact Mass | 250.21 |
| IUPAC Name | [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane |
| SMILES | CC[Si](/C=C1/C2CCC(C2)C1(C)C)(CC)CC |
| InChI | InChI=1S/C16H30Si/c1-6-17(7-2,8-3)12-15-13-9-10-14(11-13)16(15,4)5/h12-14H,6-11H2,1-5H3/b15-12- |
| InChIKey | YYQAGRXOEVAQJF-QINSGFPZSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 250.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane?
The IUPAC name of [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane (CID 140900137) is [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane.
What is the SMILES notation for [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane?
The canonical SMILES for [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane is CC[Si](/C=C1/C2CCC(C2)C1(C)C)(CC)CC.
What is the InChIKey of [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane?
The InChIKey is YYQAGRXOEVAQJF-QINSGFPZSA-N. The full InChI is InChI=1S/C16H30Si/c1-6-17(7-2,8-3)12-15-13-9-10-14(11-13)16(15,4)5/h12-14H,6-11H2,1-5H3/b15-12-.
What are the key properties of [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane?
[(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane has a molecular weight of 250.50 g/mol, XLogP of 5.42, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(3,3-dimethyl-2-bicyclo[2.2.1]heptanylidene)methyl]-triethylsilane is sourced from PubChem (CID 140900137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).