C12H28O6Si4 — CID 140900162
ethyl 2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)prop-2-enoate (PubChem CID 140900162) has the molecular formula C12H28O6Si4 and a molecular weight of 380.69 g/mol. Its IUPAC name is ethyl 2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)prop-2-enoate.
| Compound Name | ethyl 2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 140900162 |
| Molecular Formula | C12H28O6Si4 |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | ethyl 2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OCC)[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C12H28O6Si4/c1-10-14-12(13)11(2)22(9)17-20(5,6)15-19(3,4)16-21(7,8)18-22/h2,10H2,1,3-9H3 |
| InChIKey | NRPQTDMLODWEBS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|