C14H3Br3S4 — CID 140900317
4,9,15-tribromo-5,8,14,18-tetrathiapentacyclo[10.6.0.02,6.07,11.013,17]octadeca-1,3,6,9,11,13(17),15-heptaene (PubChem CID 140900317) has the molecular formula C14H3Br3S4 and a molecular weight of 539.16 g/mol. Its IUPAC name is 4,9,15-tribromo-5,8,14,18-tetrathiapentacyclo[10.6.0.02,6.07,11.013,17]octadeca-1,3,6,9,11,13(17),15-heptaene.
| Compound Name | 4,9,15-tribromo-5,8,14,18-tetrathiapentacyclo[10.6.0.02,6.07,11.013,17]octadeca-1,3,6,9,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 140900317 |
| Molecular Formula | C14H3Br3S4 |
| Molecular Weight | 539.16 g/mol |
| Exact Mass | 535.67 |
| IUPAC Name | 4,9,15-tribromo-5,8,14,18-tetrathiapentacyclo[10.6.0.02,6.07,11.013,17]octadeca-1,3,6,9,11,13(17),15-heptaene |
| SMILES | Brc1cc2c(s1)c1sc(Br)cc1c1c3sc(Br)cc3sc21 |
| InChI | InChI=1S/C14H3Br3S4/c15-7-1-4-10-11(18-6-3-9(17)21-14(6)10)5-2-8(16)20-13(5)12(4)19-7/h1-3H |
| InChIKey | PPBCONJYTSVCAW-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.16 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |