C18H34Cl2N6O — CID 140900442
1-(3,4-dichlorocyclohexyl)-3-[4-methyl-6-(2-pyrrolidin-2-ylethylamino)-1,3-diazinan-2-yl]urea (PubChem CID 140900442) has the molecular formula C18H34Cl2N6O and a molecular weight of 421.42 g/mol. Its IUPAC name is 1-(3,4-dichlorocyclohexyl)-3-[4-methyl-6-(2-pyrrolidin-2-ylethylamino)-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3,4-dichlorocyclohexyl)-3-[4-methyl-6-(2-pyrrolidin-2-ylethylamino)-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900442 |
| Molecular Formula | C18H34Cl2N6O |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-(3,4-dichlorocyclohexyl)-3-[4-methyl-6-(2-pyrrolidin-2-ylethylamino)-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCC2CCCN2)NC(NC(=O)NC2CCC(Cl)C(Cl)C2)N1 |
| InChI | InChI=1S/C18H34Cl2N6O/c1-11-9-16(22-8-6-12-3-2-7-21-12)25-17(23-11)26-18(27)24-13-4-5-14(19)15(20)10-13/h11-17,21-23,25H,2-10H2,1H3,(H2,24,26,27) |
| InChIKey | ZGAINWBAWDBTCN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|