C17H31F4N5O2 — CID 140900479
1-[4-fluoro-3-(trifluoromethyl)cyclohexyl]-3-[4-(4-hydroxybutylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900479) has the molecular formula C17H31F4N5O2 and a molecular weight of 413.46 g/mol. Its IUPAC name is 1-[4-fluoro-3-(trifluoromethyl)cyclohexyl]-3-[4-(4-hydroxybutylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-[4-fluoro-3-(trifluoromethyl)cyclohexyl]-3-[4-(4-hydroxybutylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900479 |
| Molecular Formula | C17H31F4N5O2 |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 1-[4-fluoro-3-(trifluoromethyl)cyclohexyl]-3-[4-(4-hydroxybutylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCCCO)NC(NC(=O)NC2CCC(F)C(C(F)(F)F)C2)N1 |
| InChI | InChI=1S/C17H31F4N5O2/c1-10-8-14(22-6-2-3-7-27)25-15(23-10)26-16(28)24-11-4-5-13(18)12(9-11)17(19,20)21/h10-15,22-23,25,27H,2-9H2,1H3,(H2,24,26,28) |
| InChIKey | NIYRNLXAZSNNKR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|