C16H32Cl2N6O — CID 140900511
1-(3,4-dichlorocyclohexyl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900511) has the molecular formula C16H32Cl2N6O and a molecular weight of 395.38 g/mol. Its IUPAC name is 1-(3,4-dichlorocyclohexyl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3,4-dichlorocyclohexyl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900511 |
| Molecular Formula | C16H32Cl2N6O |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-(3,4-dichlorocyclohexyl)-3-[4-[2-(dimethylamino)ethylamino]-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCN(C)C)NC(NC(=O)NC2CCC(Cl)C(Cl)C2)N1 |
| InChI | InChI=1S/C16H32Cl2N6O/c1-10-8-14(19-6-7-24(2)3)22-15(20-10)23-16(25)21-11-4-5-12(17)13(18)9-11/h10-15,19-20,22H,4-9H2,1-3H3,(H2,21,23,25) |
| InChIKey | SNGBJPWKQPLANX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|