C18H36Cl2N6O — CID 140900575
1-(3,4-dichlorocyclohexyl)-3-[4-[4-(dimethylamino)butylamino]-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900575) has the molecular formula C18H36Cl2N6O and a molecular weight of 423.43 g/mol. Its IUPAC name is 1-(3,4-dichlorocyclohexyl)-3-[4-[4-(dimethylamino)butylamino]-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3,4-dichlorocyclohexyl)-3-[4-[4-(dimethylamino)butylamino]-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900575 |
| Molecular Formula | C18H36Cl2N6O |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 1-(3,4-dichlorocyclohexyl)-3-[4-[4-(dimethylamino)butylamino]-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCCCN(C)C)NC(NC(=O)NC2CCC(Cl)C(Cl)C2)N1 |
| InChI | InChI=1S/C18H36Cl2N6O/c1-12-10-16(21-8-4-5-9-26(2)3)24-17(22-12)25-18(27)23-13-6-7-14(19)15(20)11-13/h12-17,21-22,24H,4-11H2,1-3H3,(H2,23,25,27) |
| InChIKey | IUWPFSAXNOAHAE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|