C18H37N5O2 — CID 140900597
1-(3,4-dimethylcyclohexyl)-3-[4-(4-hydroxybutylamino)-6-methyl-1,3-diazinan-2-yl]urea (PubChem CID 140900597) has the molecular formula C18H37N5O2 and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-(3,4-dimethylcyclohexyl)-3-[4-(4-hydroxybutylamino)-6-methyl-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3,4-dimethylcyclohexyl)-3-[4-(4-hydroxybutylamino)-6-methyl-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900597 |
| Molecular Formula | C18H37N5O2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.29 |
| IUPAC Name | 1-(3,4-dimethylcyclohexyl)-3-[4-(4-hydroxybutylamino)-6-methyl-1,3-diazinan-2-yl]urea |
| SMILES | CC1CC(NCCCCO)NC(NC(=O)NC2CCC(C)C(C)C2)N1 |
| InChI | InChI=1S/C18H37N5O2/c1-12-6-7-15(10-13(12)2)21-18(25)23-17-20-14(3)11-16(22-17)19-8-4-5-9-24/h12-17,19-20,22,24H,4-11H2,1-3H3,(H2,21,23,25) |
| InChIKey | KWUUMIVIDWYCMS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 97.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|