C17H32Cl2N6O2 — CID 140900606
1-(3,4-dichlorocyclohexyl)-3-[4-methyl-6-[(3-oxobutylamino)methylamino]-1,3-diazinan-2-yl]urea (PubChem CID 140900606) has the molecular formula C17H32Cl2N6O2 and a molecular weight of 423.39 g/mol. Its IUPAC name is 1-(3,4-dichlorocyclohexyl)-3-[4-methyl-6-[(3-oxobutylamino)methylamino]-1,3-diazinan-2-yl]urea.
| Compound Name | 1-(3,4-dichlorocyclohexyl)-3-[4-methyl-6-[(3-oxobutylamino)methylamino]-1,3-diazinan-2-yl]urea |
|---|---|
| PubChem CID | 140900606 |
| Molecular Formula | C17H32Cl2N6O2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-(3,4-dichlorocyclohexyl)-3-[4-methyl-6-[(3-oxobutylamino)methylamino]-1,3-diazinan-2-yl]urea |
| SMILES | CC(=O)CCNCNC1CC(C)NC(NC(=O)NC2CCC(Cl)C(Cl)C2)N1 |
| InChI | InChI=1S/C17H32Cl2N6O2/c1-10-7-15(21-9-20-6-5-11(2)26)24-16(22-10)25-17(27)23-12-3-4-13(18)14(19)8-12/h10,12-16,20-22,24H,3-9H2,1-2H3,(H2,23,25,27) |
| InChIKey | SPLSVIOTWDHCRL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|