C14H25ClN4O3 — CID 140900618
1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-3-(4-chloro-6-methyl-1,3-diazinan-2-yl)urea (PubChem CID 140900618) has the molecular formula C14H25ClN4O3 and a molecular weight of 332.83 g/mol. Its IUPAC name is 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-3-(4-chloro-6-methyl-1,3-diazinan-2-yl)urea.
| Compound Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-3-(4-chloro-6-methyl-1,3-diazinan-2-yl)urea |
|---|---|
| PubChem CID | 140900618 |
| Molecular Formula | C14H25ClN4O3 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-6-yl)-3-(4-chloro-6-methyl-1,3-diazinan-2-yl)urea |
| SMILES | CC1CC(Cl)NC(NC(=O)NC2CCC3OCCOC3C2)N1 |
| InChI | InChI=1S/C14H25ClN4O3/c1-8-6-12(15)18-13(16-8)19-14(20)17-9-2-3-10-11(7-9)22-5-4-21-10/h8-13,16,18H,2-7H2,1H3,(H2,17,19,20) |
| InChIKey | VAGJTFQARWBJAN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|