C16H29Cl2N5O3 — CID 140900634
methyl 3-[[2-[(3,4-dichlorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanoate (PubChem CID 140900634) has the molecular formula C16H29Cl2N5O3 and a molecular weight of 410.35 g/mol. Its IUPAC name is methyl 3-[[2-[(3,4-dichlorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanoate.
| Compound Name | methyl 3-[[2-[(3,4-dichlorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 140900634 |
| Molecular Formula | C16H29Cl2N5O3 |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | methyl 3-[[2-[(3,4-dichlorocyclohexyl)carbamoylamino]-6-methyl-1,3-diazinan-4-yl]amino]propanoate |
| SMILES | COC(=O)CCNC1CC(C)NC(NC(=O)NC2CCC(Cl)C(Cl)C2)N1 |
| InChI | InChI=1S/C16H29Cl2N5O3/c1-9-7-13(19-6-5-14(24)26-2)22-15(20-9)23-16(25)21-10-3-4-11(17)12(18)8-10/h9-13,15,19-20,22H,3-8H2,1-2H3,(H2,21,23,25) |
| InChIKey | MHUVZUATBVTOJB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|