C25H31F6N3O2Si — CID 140900794
1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-[3-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-3-amine (PubChem CID 140900794) has the molecular formula C25H31F6N3O2Si and a molecular weight of 547.62 g/mol. Its IUPAC name is 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-[3-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-3-amine.
| Compound Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-[3-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-3-amine |
|---|---|
| PubChem CID | 140900794 |
| Molecular Formula | C25H31F6N3O2Si |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 1-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-6-[3-fluoro-2-(2,2,3,3,3-pentafluoropropoxy)phenyl]indazol-3-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCCCn1nc(N)c2ccc(-c3cccc(F)c3OCC(F)(F)C(F)(F)F)cc21 |
| InChI | InChI=1S/C25H31F6N3O2Si/c1-23(2,3)37(4,5)36-13-7-12-34-20-14-16(10-11-18(20)22(32)33-34)17-8-6-9-19(26)21(17)35-15-24(27,28)25(29,30)31/h6,8-11,14H,7,12-13,15H2,1-5H3,(H2,32,33) |
| InChIKey | YKNQZUDUUUUMNK-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|