About 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one
8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one (PubChem CID 140900846) has the molecular formula C11H13N3O
and a molecular weight of 203.24 g/mol. Its IUPAC name is 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one.
Molecular Properties
| Compound Name | 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one |
| PubChem CID | 140900846 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one |
| SMILES | CC(C)(C)c1ccnc2[nH]c(=O)cnc12 |
| InChI | InChI=1S/C11H13N3O/c1-11(2,3)7-4-5-12-10-9(7)13-6-8(15)14-10/h4-6H,1-3H3,(H,12,14,15) |
| InChIKey | MJKHZGRBGQPCIL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one?
The IUPAC name of 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one (CID 140900846) is 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one.
What is the SMILES notation for 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one?
The canonical SMILES for 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one is CC(C)(C)c1ccnc2[nH]c(=O)cnc12.
What is the InChIKey of 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one?
The InChIKey is MJKHZGRBGQPCIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O/c1-11(2,3)7-4-5-12-10-9(7)13-6-8(15)14-10/h4-6H,1-3H3,(H,12,14,15).
What are the key properties of 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one?
8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one has a molecular weight of 203.24 g/mol, XLogP of 1.62, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-4H-pyrido[2,3-b]pyrazin-3-one is sourced from PubChem (CID 140900846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).