C23H26N2O6 — CID 140901090
N-[2,4,6-trimethoxy-3-[4-methoxy-3-[[(Z)-3-oxobut-1-enyl]amino]phenyl]phenyl]prop-2-enamide (PubChem CID 140901090) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[2,4,6-trimethoxy-3-[4-methoxy-3-[[(Z)-3-oxobut-1-enyl]amino]phenyl]phenyl]prop-2-enamide.
| Compound Name | N-[2,4,6-trimethoxy-3-[4-methoxy-3-[[(Z)-3-oxobut-1-enyl]amino]phenyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 140901090 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-[2,4,6-trimethoxy-3-[4-methoxy-3-[[(Z)-3-oxobut-1-enyl]amino]phenyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1c(OC)cc(OC)c(-c2ccc(OC)c(N/C=C\C(C)=O)c2)c1OC |
| InChI | InChI=1S/C23H26N2O6/c1-7-20(27)25-22-19(30-5)13-18(29-4)21(23(22)31-6)15-8-9-17(28-3)16(12-15)24-11-10-14(2)26/h7-13,24H,1H2,2-6H3,(H,25,27)/b11-10- |
| InChIKey | AZYBPLKANOUEGY-KHPPLWFESA-N |
| XLogP | 4.03 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|