C21H35NO8 — CID 140901124
[(E)-(3-carboxyoxy-2-ethyl-12-hydroxy-9,11,13-trimethyl-14-oxo-oxacyclotetradec-6-ylidene)amino] acetate (PubChem CID 140901124) has the molecular formula C21H35NO8 and a molecular weight of 429.51 g/mol. Its IUPAC name is [(E)-(3-carboxyoxy-2-ethyl-12-hydroxy-9,11,13-trimethyl-14-oxo-oxacyclotetradec-6-ylidene)amino] acetate.
| Compound Name | [(E)-(3-carboxyoxy-2-ethyl-12-hydroxy-9,11,13-trimethyl-14-oxo-oxacyclotetradec-6-ylidene)amino] acetate |
|---|---|
| PubChem CID | 140901124 |
| Molecular Formula | C21H35NO8 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | [(E)-(3-carboxyoxy-2-ethyl-12-hydroxy-9,11,13-trimethyl-14-oxo-oxacyclotetradec-6-ylidene)amino] acetate |
| SMILES | CCC1OC(=O)C(C)C(O)C(C)CC(C)CC/C(=N\OC(C)=O)CCC1OC(=O)O |
| InChI | InChI=1S/C21H35NO8/c1-6-17-18(29-21(26)27)10-9-16(22-30-15(5)23)8-7-12(2)11-13(3)19(24)14(4)20(25)28-17/h12-14,17-19,24H,6-11H2,1-5H3,(H,26,27)/b22-16+ |
| InChIKey | AWYSCOKBBFPMRS-CJLVFECKSA-N |
| XLogP | 3.52 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|