C51H34N3O2P — CID 140901914
2-dibenzofuran-4-yl-4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 140901914) has the molecular formula C51H34N3O2P and a molecular weight of 751.83 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-dibenzofuran-4-yl-4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 140901914 |
| Molecular Formula | C51H34N3O2P |
| Molecular Weight | 751.83 g/mol |
| Exact Mass | 751.24 |
| IUPAC Name | 2-dibenzofuran-4-yl-4-[4-[4-(4-diphenylphosphorylphenyl)phenyl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5cccc6c5oc5ccccc56)n4)cc3)cc2)cc1 |
| InChI | InChI=1S/C51H34N3O2P/c55-57(41-15-6-2-7-16-41,42-17-8-3-9-18-42)43-33-31-38(32-34-43)36-25-23-35(24-26-36)37-27-29-40(30-28-37)50-52-49(39-13-4-1-5-14-39)53-51(54-50)46-21-12-20-45-44-19-10-11-22-47(44)56-48(45)46/h1-34H |
| InChIKey | RLVUHLRUAGRVNI-UHFFFAOYSA-N |
| XLogP | 11.75 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.83 |
| LogP ≤ 5 | 11.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|