C29H29BN2O2 — CID 140902864
N-(2-phenylphenyl)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridin-2-amine (PubChem CID 140902864) has the molecular formula C29H29BN2O2 and a molecular weight of 448.38 g/mol. Its IUPAC name is N-(2-phenylphenyl)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridin-2-amine.
| Compound Name | N-(2-phenylphenyl)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 140902864 |
| Molecular Formula | C29H29BN2O2 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | N-(2-phenylphenyl)-N-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridin-2-amine |
| SMILES | CC1(C)OB(c2cccc(N(c3ccccn3)c3ccccc3-c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C29H29BN2O2/c1-28(2)29(3,4)34-30(33-28)23-15-12-16-24(21-23)32(27-19-10-11-20-31-27)26-18-9-8-17-25(26)22-13-6-5-7-14-22/h5-21H,1-4H3 |
| InChIKey | CYDQCWOAVNODIY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|