C49H45N4OPt- — CID 140902933
2-[4-[3-(3,5-ditert-butylphenyl)-5-[naphthalen-1-yl(pyridin-2-yl)amino]benzene-6-id-1-yl]-1-methylbenzimidazol-2-yl]phenol;platinum (PubChem CID 140902933) has the molecular formula C49H45N4OPt- and a molecular weight of 901.00 g/mol. Its IUPAC name is 2-[4-[3-(3,5-ditert-butylphenyl)-5-[naphthalen-1-yl(pyridin-2-yl)amino]benzene-6-id-1-yl]-1-methylbenzimidazol-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-(3,5-ditert-butylphenyl)-5-[naphthalen-1-yl(pyridin-2-yl)amino]benzene-6-id-1-yl]-1-methylbenzimidazol-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 140902933 |
| Molecular Formula | C49H45N4OPt- |
| Molecular Weight | 901.00 g/mol |
| Exact Mass | 900.32 |
| IUPAC Name | 2-[4-[3-(3,5-ditert-butylphenyl)-5-[naphthalen-1-yl(pyridin-2-yl)amino]benzene-6-id-1-yl]-1-methylbenzimidazol-2-yl]phenol;platinum |
| SMILES | Cn1c(-c2ccccc2O)nc2c(-c3[c-]c(N(c4ccccn4)c4cccc5ccccc45)cc(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c3)cccc21.[Pt] |
| InChI | InChI=1S/C49H45N4O.Pt/c1-48(2,3)36-27-34(28-37(31-36)49(4,5)6)33-26-35(40-20-15-22-43-46(40)51-47(52(43)7)41-19-10-11-23-44(41)54)30-38(29-33)53(45-24-12-13-25-50-45)42-21-14-17-32-16-8-9-18-39(32)42;/h8-29,31,54H,1-7H3;/q-1; |
| InChIKey | IKOOXOUJTVCAIM-UHFFFAOYSA-N |
| XLogP | 12.69 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.00 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|