C43H25N5 — CID 140903795
18-(4,6-diphenyl-1,3,5-triazin-2-yl)-22-(4-isocyanophenyl)-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaene (PubChem CID 140903795) has the molecular formula C43H25N5 and a molecular weight of 611.71 g/mol. Its IUPAC name is 18-(4,6-diphenyl-1,3,5-triazin-2-yl)-22-(4-isocyanophenyl)-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaene.
| Compound Name | 18-(4,6-diphenyl-1,3,5-triazin-2-yl)-22-(4-isocyanophenyl)-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaene |
|---|---|
| PubChem CID | 140903795 |
| Molecular Formula | C43H25N5 |
| Molecular Weight | 611.71 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 18-(4,6-diphenyl-1,3,5-triazin-2-yl)-22-(4-isocyanophenyl)-21-azapentacyclo[12.8.0.02,7.08,13.015,20]docosa-1(14),2,4,6,8,10,12,15(20),16,18,21-undecaene |
| SMILES | [C-]#[N+]c1ccc(-c2nc3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3c3c4ccccc4c4ccccc4c23)cc1 |
| InChI | InChI=1S/C43H25N5/c1-44-31-23-20-27(21-24-31)40-39-35-19-11-9-17-33(35)32-16-8-10-18-34(32)38(39)36-25-22-30(26-37(36)45-40)43-47-41(28-12-4-2-5-13-28)46-42(48-43)29-14-6-3-7-15-29/h2-26H |
| InChIKey | VJYZPSNPRJQEPI-UHFFFAOYSA-N |
| XLogP | 11.10 |
| TPSA | 55.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.71 |
| LogP ≤ 5 | 11.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|