About 7-butylpyrano[4,3-b]pyridin-5-one
7-butylpyrano[4,3-b]pyridin-5-one (PubChem CID 14090391) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 7-butylpyrano[4,3-b]pyridin-5-one.
Molecular Properties
| Compound Name | 7-butylpyrano[4,3-b]pyridin-5-one |
| PubChem CID | 14090391 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 7-butylpyrano[4,3-b]pyridin-5-one |
| SMILES | CCCCc1cc2ncccc2c(=O)o1 |
| InChI | InChI=1S/C12H13NO2/c1-2-3-5-9-8-11-10(12(14)15-9)6-4-7-13-11/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | RZFGVASDSAVERO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-butylpyrano[4,3-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butylpyrano[4,3-b]pyridin-5-one?
The IUPAC name of 7-butylpyrano[4,3-b]pyridin-5-one (CID 14090391) is 7-butylpyrano[4,3-b]pyridin-5-one.
What is the SMILES notation for 7-butylpyrano[4,3-b]pyridin-5-one?
The canonical SMILES for 7-butylpyrano[4,3-b]pyridin-5-one is CCCCc1cc2ncccc2c(=O)o1.
What is the InChIKey of 7-butylpyrano[4,3-b]pyridin-5-one?
The InChIKey is RZFGVASDSAVERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-2-3-5-9-8-11-10(12(14)15-9)6-4-7-13-11/h4,6-8H,2-3,5H2,1H3.
What are the key properties of 7-butylpyrano[4,3-b]pyridin-5-one?
7-butylpyrano[4,3-b]pyridin-5-one has a molecular weight of 203.24 g/mol, XLogP of 2.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butylpyrano[4,3-b]pyridin-5-one is sourced from PubChem (CID 14090391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).