C32H54N8+4 — CID 140904253
1-methyl-8-[[4-[(7-methyl-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecan-1-yl)methyl]phenyl]methyl]-4,11-diaza-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadecane (PubChem CID 140904253) has the molecular formula C32H54N8+4 and a molecular weight of 550.84 g/mol. Its IUPAC name is 1-methyl-8-[[4-[(7-methyl-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecan-1-yl)methyl]phenyl]methyl]-4,11-diaza-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadecane.
| Compound Name | 1-methyl-8-[[4-[(7-methyl-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecan-1-yl)methyl]phenyl]methyl]-4,11-diaza-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadecane |
|---|---|
| PubChem CID | 140904253 |
| Molecular Formula | C32H54N8+4 |
| Molecular Weight | 550.84 g/mol |
| Exact Mass | 550.44 |
| IUPAC Name | 1-methyl-8-[[4-[(7-methyl-4,10-diaza-1,7-diazoniatetracyclo[5.5.2.04,13.010,14]tetradecan-1-yl)methyl]phenyl]methyl]-4,11-diaza-1,8-diazoniatetracyclo[6.6.2.04,16.011,15]hexadecane |
| SMILES | C[N+]12CCCN3CC[N+]4(Cc5ccc(C[N+]67CCN8CC[N+]9(C)CCN(CC6)C7C89)cc5)CCCN(CC1)C4C32 |
| InChI | InChI=1S/C32H54N8/c1-37-17-3-9-33-14-22-39(18-4-10-34(11-19-37)31(39)29(33)37)25-27-5-7-28(8-6-27)26-40-23-15-35-12-20-38(2)21-13-36(16-24-40)32(40)30(35)38/h5-8,29-32H,3-4,9-26H2,1-2H3/q+4 |
| InChIKey | VYCWWUCPASXZCS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.84 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|