C60H39Br3N6O3 — CID 140904599
1-N,3-N,5-N-tris(2-bromo-4-pyridin-2-ylphenyl)-1-N,3-N,5-N-triphenylbenzene-1,3,5-tricarboxamide (PubChem CID 140904599) has the molecular formula C60H39Br3N6O3 and a molecular weight of 1131.72 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(2-bromo-4-pyridin-2-ylphenyl)-1-N,3-N,5-N-triphenylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,5-N-tris(2-bromo-4-pyridin-2-ylphenyl)-1-N,3-N,5-N-triphenylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 140904599 |
| Molecular Formula | C60H39Br3N6O3 |
| Molecular Weight | 1131.72 g/mol |
| Exact Mass | 1128.06 |
| IUPAC Name | 1-N,3-N,5-N-tris(2-bromo-4-pyridin-2-ylphenyl)-1-N,3-N,5-N-triphenylbenzene-1,3,5-tricarboxamide |
| SMILES | O=C(c1cc(C(=O)N(c2ccccc2)c2ccc(-c3ccccn3)cc2Br)cc(C(=O)N(c2ccccc2)c2ccc(-c3ccccn3)cc2Br)c1)N(c1ccccc1)c1ccc(-c2ccccn2)cc1Br |
| InChI | InChI=1S/C60H39Br3N6O3/c61-49-37-40(52-22-10-13-31-64-52)25-28-55(49)67(46-16-4-1-5-17-46)58(70)43-34-44(59(71)68(47-18-6-2-7-19-47)56-29-26-41(38-50(56)62)53-23-11-14-32-65-53)36-45(35-43)60(72)69(48-20-8-3-9-21-48)57-30-27-42(39-51(57)63)54-24-12-15-33-66-54/h1-39H |
| InChIKey | VUVCTGGZJYUKSI-UHFFFAOYSA-N |
| XLogP | 16.10 |
| TPSA | 99.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1131.72 |
| LogP ≤ 5 | 16.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |