C78H42IrN3O9 — CID 140904753
iridium(3+);tris[6-(3-dibenzofuran-4-ylbenzene-6-id-1-yl)-3-pyridinyl] benzene-1,3,5-tricarboxylate (PubChem CID 140904753) has the molecular formula C78H42IrN3O9 and a molecular weight of 1357.42 g/mol. Its IUPAC name is iridium(3+);tris[6-(3-dibenzofuran-4-ylbenzene-6-id-1-yl)-3-pyridinyl] benzene-1,3,5-tricarboxylate.
| Compound Name | iridium(3+);tris[6-(3-dibenzofuran-4-ylbenzene-6-id-1-yl)-3-pyridinyl] benzene-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 140904753 |
| Molecular Formula | C78H42IrN3O9 |
| Molecular Weight | 1357.42 g/mol |
| Exact Mass | 1357.26 |
| IUPAC Name | iridium(3+);tris[6-(3-dibenzofuran-4-ylbenzene-6-id-1-yl)-3-pyridinyl] benzene-1,3,5-tricarboxylate |
| SMILES | O=C(Oc1ccc(-c2[c-]ccc(-c3cccc4c3oc3ccccc34)c2)nc1)c1cc(C(=O)Oc2ccc(-c3[c-]ccc(-c4cccc5c4oc4ccccc45)c3)nc2)cc(C(=O)Oc2ccc(-c3[c-]ccc(-c4cccc5c4oc4ccccc45)c3)nc2)c1.[Ir+3] |
| InChI | InChI=1S/C78H42N3O9.Ir/c82-76(85-55-31-34-67(79-43-55)49-16-7-13-46(37-49)58-22-10-25-64-61-19-1-4-28-70(61)88-73(58)64)52-40-53(77(83)86-56-32-35-68(80-44-56)50-17-8-14-47(38-50)59-23-11-26-65-62-20-2-5-29-71(62)89-74(59)65)42-54(41-52)78(84)87-57-33-36-69(81-45-57)51-18-9-15-48(39-51)60-24-12-27-66-63-21-3-6-30-72(63)90-75(60)66;/h1-15,19-45H;/q-3;+3 |
| InChIKey | YHLCASDIBMLBIA-UHFFFAOYSA-N |
| XLogP | 18.63 |
| TPSA | 156.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 91 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1357.42 |
| LogP ≤ 5 | 18.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|