C33H54N2O9Si — CID 140905051
tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-nitro-2-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxyanilino]acetate (PubChem CID 140905051) has the molecular formula C33H54N2O9Si and a molecular weight of 650.89 g/mol. Its IUPAC name is tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-nitro-2-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxyanilino]acetate.
| Compound Name | tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-nitro-2-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxyanilino]acetate |
|---|---|
| PubChem CID | 140905051 |
| Molecular Formula | C33H54N2O9Si |
| Molecular Weight | 650.89 g/mol |
| Exact Mass | 650.36 |
| IUPAC Name | tert-butyl 2-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-N-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4-nitro-2-[(1S,2S)-2-prop-2-enoxycyclopentyl]oxyanilino]acetate |
| SMILES | C=CCO[C@H]1CCC[C@@H]1Oc1cc([N+](=O)[O-])c(CO[Si](C)(C)C(C)(C)C)cc1N(CC(=O)OC(C)(C)C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H54N2O9Si/c1-13-17-40-26-15-14-16-27(26)42-28-19-24(35(38)39)23(22-41-45(11,12)33(8,9)10)18-25(28)34(20-29(36)43-31(2,3)4)21-30(37)44-32(5,6)7/h13,18-19,26-27H,1,14-17,20-22H2,2-12H3/t26-,27-/m0/s1 |
| InChIKey | XZHLVERJAQGRNA-SVBPBHIXSA-N |
| XLogP | 7.11 |
| TPSA | 126.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.89 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|