C20H16N2O2 — CID 140905318
3-[3-[4-(hydroxymethyl)phenyl]pyrrolo[1,2-a]pyrazin-6-yl]phenol (PubChem CID 140905318) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-[3-[4-(hydroxymethyl)phenyl]pyrrolo[1,2-a]pyrazin-6-yl]phenol.
| Compound Name | 3-[3-[4-(hydroxymethyl)phenyl]pyrrolo[1,2-a]pyrazin-6-yl]phenol |
|---|---|
| PubChem CID | 140905318 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-[3-[4-(hydroxymethyl)phenyl]pyrrolo[1,2-a]pyrazin-6-yl]phenol |
| SMILES | OCc1ccc(-c2cn3c(-c4cccc(O)c4)ccc3cn2)cc1 |
| InChI | InChI=1S/C20H16N2O2/c23-13-14-4-6-15(7-5-14)19-12-22-17(11-21-19)8-9-20(22)16-2-1-3-18(24)10-16/h1-12,23-24H,13H2 |
| InChIKey | XUZLZXYVERZDES-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |