C40H23N3O — CID 140905591
16-[4-(2,3,4,5,6-pentadeuteriophenyl)benzo[h]quinazolin-2-yl]-9-oxa-16-azahexacyclo[11.11.0.02,10.03,8.015,23.017,22]tetracosa-1(24),2(10),3,5,7,11,13,15(23),17,19,21-undecaene (PubChem CID 140905591) has the molecular formula C40H23N3O and a molecular weight of 566.67 g/mol. Its IUPAC name is 16-[4-(2,3,4,5,6-pentadeuteriophenyl)benzo[h]quinazolin-2-yl]-9-oxa-16-azahexacyclo[11.11.0.02,10.03,8.015,23.017,22]tetracosa-1(24),2(10),3,5,7,11,13,15(23),17,19,21-undecaene.
| Compound Name | 16-[4-(2,3,4,5,6-pentadeuteriophenyl)benzo[h]quinazolin-2-yl]-9-oxa-16-azahexacyclo[11.11.0.02,10.03,8.015,23.017,22]tetracosa-1(24),2(10),3,5,7,11,13,15(23),17,19,21-undecaene |
|---|---|
| PubChem CID | 140905591 |
| Molecular Formula | C40H23N3O |
| Molecular Weight | 566.67 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 16-[4-(2,3,4,5,6-pentadeuteriophenyl)benzo[h]quinazolin-2-yl]-9-oxa-16-azahexacyclo[11.11.0.02,10.03,8.015,23.017,22]tetracosa-1(24),2(10),3,5,7,11,13,15(23),17,19,21-undecaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-n3c4ccccc4c4cc5c(ccc6oc7ccccc7c65)cc43)nc3c2ccc2ccccc23)c([2H])c1[2H] |
| InChI | InChI=1S/C40H23N3O/c1-2-11-25(12-3-1)38-30-20-18-24-10-4-5-13-27(24)39(30)42-40(41-38)43-33-16-8-6-14-28(33)32-23-31-26(22-34(32)43)19-21-36-37(31)29-15-7-9-17-35(29)44-36/h1-23H/i1D,2D,3D,11D,12D |
| InChIKey | AEOKGPGDGJSHAB-QJJXXHCMSA-N |
| XLogP | 10.60 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.67 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|