C11H18O2 — CID 14090579
(2S,3R)-2-butyl-3,5-dimethyl-2,3-dihydropyran-4-one (PubChem CID 14090579) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (2S,3R)-2-butyl-3,5-dimethyl-2,3-dihydropyran-4-one.
| Compound Name | (2S,3R)-2-butyl-3,5-dimethyl-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 14090579 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2S,3R)-2-butyl-3,5-dimethyl-2,3-dihydropyran-4-one |
| SMILES | CCCC[C@@H]1OC=C(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C11H18O2/c1-4-5-6-10-9(3)11(12)8(2)7-13-10/h7,9-10H,4-6H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | KPNXGLWLLLPPPT-ZJUUUORDSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |