C25H35BrClNO8 — CID 140905864
1-O-tert-butyl 2-O,2-O'-diethyl (5R)-5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]pyrrolidine-1,2,2-tricarboxylate (PubChem CID 140905864) has the molecular formula C25H35BrClNO8 and a molecular weight of 592.91 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,2-O'-diethyl (5R)-5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]pyrrolidine-1,2,2-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,2-O'-diethyl (5R)-5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]pyrrolidine-1,2,2-tricarboxylate |
|---|---|
| PubChem CID | 140905864 |
| Molecular Formula | C25H35BrClNO8 |
| Molecular Weight | 592.91 g/mol |
| Exact Mass | 591.12 |
| IUPAC Name | 1-O-tert-butyl 2-O,2-O'-diethyl (5R)-5-[2-bromo-4-chloro-5-(3-methoxypropoxy)phenyl]pyrrolidine-1,2,2-tricarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC[C@H](c2cc(OCCCOC)c(Cl)cc2Br)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H35BrClNO8/c1-7-33-21(29)25(22(30)34-8-2)11-10-19(28(25)23(31)36-24(3,4)5)16-14-20(18(27)15-17(16)26)35-13-9-12-32-6/h14-15,19H,7-13H2,1-6H3/t19-/m1/s1 |
| InChIKey | MFQHMPKYSMXIHW-LJQANCHMSA-N |
| XLogP | 5.45 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.91 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|