About ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate
ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate (PubChem CID 140906761) has the molecular formula C13H19N3O5
and a molecular weight of 297.31 g/mol. Its IUPAC name is ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate |
| PubChem CID | 140906761 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NCCC1NC(=O)C(C)NC1=O |
| InChI | InChI=1S/C13H19N3O5/c1-3-21-11(18)5-4-10(17)14-7-6-9-13(20)15-8(2)12(19)16-9/h4-5,8-9H,3,6-7H2,1-2H3,(H,14,17)(H,15,20)(H,16,19)/b5-4+ |
| InChIKey | XPYZUWNCJYIEPN-SNAWJCMRSA-N |
| XLogP | -1.38 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate?
The IUPAC name of ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate (CID 140906761) is ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate.
What is the SMILES notation for ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate?
The canonical SMILES for ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate is CCOC(=O)/C=C/C(=O)NCCC1NC(=O)C(C)NC1=O.
What is the InChIKey of ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate?
The InChIKey is XPYZUWNCJYIEPN-SNAWJCMRSA-N. The full InChI is InChI=1S/C13H19N3O5/c1-3-21-11(18)5-4-10(17)14-7-6-9-13(20)15-8(2)12(19)16-9/h4-5,8-9H,3,6-7H2,1-2H3,(H,14,17)(H,15,20)(H,16,19)/b5-4+.
What are the key properties of ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate?
ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate has a molecular weight of 297.31 g/mol, XLogP of -1.38, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4-[2-(5-methyl-3,6-dioxopiperazin-2-yl)ethylamino]-4-oxobut-2-enoate is sourced from PubChem (CID 140906761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).