About 1-piperidin-4-ylindole
1-piperidin-4-ylindole (PubChem CID 14090755) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is 1-piperidin-4-ylindole.
Molecular Properties
| Compound Name | 1-piperidin-4-ylindole |
| PubChem CID | 14090755 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 1-piperidin-4-ylindole |
| SMILES | c1ccc2c(c1)ccn2C1CCNCC1 |
| InChI | InChI=1S/C13H16N2/c1-2-4-13-11(3-1)7-10-15(13)12-5-8-14-9-6-12/h1-4,7,10,12,14H,5-6,8-9H2 |
| InChIKey | RQEDXUKWSYJDPG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-piperidin-4-ylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-ylindole?
The IUPAC name of 1-piperidin-4-ylindole (CID 14090755) is 1-piperidin-4-ylindole.
What is the SMILES notation for 1-piperidin-4-ylindole?
The canonical SMILES for 1-piperidin-4-ylindole is c1ccc2c(c1)ccn2C1CCNCC1.
What is the InChIKey of 1-piperidin-4-ylindole?
The InChIKey is RQEDXUKWSYJDPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-2-4-13-11(3-1)7-10-15(13)12-5-8-14-9-6-12/h1-4,7,10,12,14H,5-6,8-9H2.
What are the key properties of 1-piperidin-4-ylindole?
1-piperidin-4-ylindole has a molecular weight of 200.29 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-ylindole is sourced from PubChem (CID 14090755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).