About N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine
N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine (PubChem CID 140908068) has the molecular formula C19H41N3O
and a molecular weight of 327.56 g/mol. Its IUPAC name is N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine |
| PubChem CID | 140908068 |
| Molecular Formula | C19H41N3O |
| Molecular Weight | 327.56 g/mol |
| Exact Mass | 327.32 |
| IUPAC Name | N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)CCCN1CCN(CCOCCNC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H41N3O/c1-18(2,3)8-7-10-21-11-13-22(14-12-21)15-17-23-16-9-20-19(4,5)6/h20H,7-17H2,1-6H3 |
| InChIKey | OZSIQSFXEXDDAP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine?
The IUPAC name of N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine (CID 140908068) is N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine.
What is the SMILES notation for N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine?
The canonical SMILES for N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine is CC(C)(C)CCCN1CCN(CCOCCNC(C)(C)C)CC1.
What is the InChIKey of N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine?
The InChIKey is OZSIQSFXEXDDAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41N3O/c1-18(2,3)8-7-10-21-11-13-22(14-12-21)15-17-23-16-9-20-19(4,5)6/h20H,7-17H2,1-6H3.
What are the key properties of N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine?
N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine has a molecular weight of 327.56 g/mol, XLogP of 2.84, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-[4-(4,4-dimethylpentyl)piperazin-1-yl]ethoxy]ethyl]-2-methylpropan-2-amine is sourced from PubChem (CID 140908068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).