C27H36B3N3 — CID 140908098
2,4,6-tris(2,6-dimethylphenyl)-1,3,5-trimethyl-1,3,5,2,4,6-triazatriborinane (PubChem CID 140908098) has the molecular formula C27H36B3N3 and a molecular weight of 435.04 g/mol. Its IUPAC name is 2,4,6-tris(2,6-dimethylphenyl)-1,3,5-trimethyl-1,3,5,2,4,6-triazatriborinane.
| Compound Name | 2,4,6-tris(2,6-dimethylphenyl)-1,3,5-trimethyl-1,3,5,2,4,6-triazatriborinane |
|---|---|
| PubChem CID | 140908098 |
| Molecular Formula | C27H36B3N3 |
| Molecular Weight | 435.04 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | 2,4,6-tris(2,6-dimethylphenyl)-1,3,5-trimethyl-1,3,5,2,4,6-triazatriborinane |
| SMILES | Cc1cccc(C)c1B1N(C)B(c2c(C)cccc2C)N(C)B(c2c(C)cccc2C)N1C |
| InChI | InChI=1S/C27H36B3N3/c1-19-13-10-14-20(2)25(19)28-31(7)29(26-21(3)15-11-16-22(26)4)33(9)30(32(28)8)27-23(5)17-12-18-24(27)6/h10-18H,1-9H3 |
| InChIKey | JQMVRUXKNBUVMS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.04 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|