C50H43N3Si — CID 140908668
N-[3-(5-methyl-4-phenyl-2-pyridinyl)phenyl]-2-phenyl-N-[3-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]aniline (PubChem CID 140908668) has the molecular formula C50H43N3Si and a molecular weight of 714.00 g/mol. Its IUPAC name is N-[3-(5-methyl-4-phenyl-2-pyridinyl)phenyl]-2-phenyl-N-[3-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]aniline.
| Compound Name | N-[3-(5-methyl-4-phenyl-2-pyridinyl)phenyl]-2-phenyl-N-[3-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]aniline |
|---|---|
| PubChem CID | 140908668 |
| Molecular Formula | C50H43N3Si |
| Molecular Weight | 714.00 g/mol |
| Exact Mass | 713.32 |
| IUPAC Name | N-[3-(5-methyl-4-phenyl-2-pyridinyl)phenyl]-2-phenyl-N-[3-(4-phenyl-5-trimethylsilyl-2-pyridinyl)phenyl]aniline |
| SMILES | Cc1cnc(-c2cccc(N(c3cccc(-c4cc(-c5ccccc5)c([Si](C)(C)C)cn4)c3)c3ccccc3-c3ccccc3)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C50H43N3Si/c1-36-34-51-47(32-45(36)38-20-10-6-11-21-38)40-24-16-26-42(30-40)53(49-29-15-14-28-44(49)37-18-8-5-9-19-37)43-27-17-25-41(31-43)48-33-46(39-22-12-7-13-23-39)50(35-52-48)54(2,3)4/h5-35H,1-4H3 |
| InChIKey | CHOVBFKGVKHAJQ-UHFFFAOYSA-N |
| XLogP | 13.14 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.00 |
| LogP ≤ 5 | 13.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|