About (E)-4-phenylpent-3-enal
(E)-4-phenylpent-3-enal (PubChem CID 14090897) has the molecular formula C11H12O
and a molecular weight of 160.22 g/mol. Its IUPAC name is (E)-4-phenylpent-3-enal.
Molecular Properties
| Compound Name | (E)-4-phenylpent-3-enal |
| PubChem CID | 14090897 |
| Molecular Formula | C11H12O |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (E)-4-phenylpent-3-enal |
| SMILES | C/C(=C\CC=O)c1ccccc1 |
| InChI | InChI=1S/C11H12O/c1-10(6-5-9-12)11-7-3-2-4-8-11/h2-4,6-9H,5H2,1H3/b10-6+ |
| InChIKey | GTDCDFKGLIWDJX-UXBLZVDNSA-N |
| XLogP | 2.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-phenylpent-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-phenylpent-3-enal?
The IUPAC name of (E)-4-phenylpent-3-enal (CID 14090897) is (E)-4-phenylpent-3-enal.
What is the SMILES notation for (E)-4-phenylpent-3-enal?
The canonical SMILES for (E)-4-phenylpent-3-enal is C/C(=C\CC=O)c1ccccc1.
What is the InChIKey of (E)-4-phenylpent-3-enal?
The InChIKey is GTDCDFKGLIWDJX-UXBLZVDNSA-N. The full InChI is InChI=1S/C11H12O/c1-10(6-5-9-12)11-7-3-2-4-8-11/h2-4,6-9H,5H2,1H3/b10-6+.
What are the key properties of (E)-4-phenylpent-3-enal?
(E)-4-phenylpent-3-enal has a molecular weight of 160.22 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-phenylpent-3-enal is sourced from PubChem (CID 14090897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).