C39H52FN5O6Si — CID 140909049
tert-butyl 2-[6-(2-ethyl-5-fluoro-4-methoxyphenyl)-1-(oxan-2-yl)indazol-3-yl]-6-formyl-3-(2-trimethylsilylethoxymethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate (PubChem CID 140909049) has the molecular formula C39H52FN5O6Si and a molecular weight of 733.96 g/mol. Its IUPAC name is tert-butyl 2-[6-(2-ethyl-5-fluoro-4-methoxyphenyl)-1-(oxan-2-yl)indazol-3-yl]-6-formyl-3-(2-trimethylsilylethoxymethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[6-(2-ethyl-5-fluoro-4-methoxyphenyl)-1-(oxan-2-yl)indazol-3-yl]-6-formyl-3-(2-trimethylsilylethoxymethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 140909049 |
| Molecular Formula | C39H52FN5O6Si |
| Molecular Weight | 733.96 g/mol |
| Exact Mass | 733.37 |
| IUPAC Name | tert-butyl 2-[6-(2-ethyl-5-fluoro-4-methoxyphenyl)-1-(oxan-2-yl)indazol-3-yl]-6-formyl-3-(2-trimethylsilylethoxymethyl)-6,7-dihydro-4H-imidazo[4,5-c]pyridine-5-carboxylate |
| SMILES | CCc1cc(OC)c(F)cc1-c1ccc2c(-c3nc4c(n3COCC[Si](C)(C)C)CN(C(=O)OC(C)(C)C)C(C=O)C4)nn(C3CCCCO3)c2c1 |
| InChI | InChI=1S/C39H52FN5O6Si/c1-9-25-19-34(48-5)30(40)21-29(25)26-13-14-28-32(18-26)45(35-12-10-11-15-50-35)42-36(28)37-41-31-20-27(23-46)43(38(47)51-39(2,3)4)22-33(31)44(37)24-49-16-17-52(6,7)8/h13-14,18-19,21,23,27,35H,9-12,15-17,20,22,24H2,1-8H3 |
| InChIKey | XMDOOULKENARFA-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 109.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.96 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|