C24H26F4O2S — CID 140909183
3-butylsulfanyl-7-(4-ethoxycyclohexyl)-1,2,8,9-tetrafluorodibenzofuran (PubChem CID 140909183) has the molecular formula C24H26F4O2S and a molecular weight of 454.53 g/mol. Its IUPAC name is 3-butylsulfanyl-7-(4-ethoxycyclohexyl)-1,2,8,9-tetrafluorodibenzofuran.
| Compound Name | 3-butylsulfanyl-7-(4-ethoxycyclohexyl)-1,2,8,9-tetrafluorodibenzofuran |
|---|---|
| PubChem CID | 140909183 |
| Molecular Formula | C24H26F4O2S |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 3-butylsulfanyl-7-(4-ethoxycyclohexyl)-1,2,8,9-tetrafluorodibenzofuran |
| SMILES | CCCCSc1cc2oc3cc(C4CCC(OCC)CC4)c(F)c(F)c3c2c(F)c1F |
| InChI | InChI=1S/C24H26F4O2S/c1-3-5-10-31-18-12-17-20(24(28)22(18)26)19-16(30-17)11-15(21(25)23(19)27)13-6-8-14(9-7-13)29-4-2/h11-14H,3-10H2,1-2H3 |
| InChIKey | ZWGNZEYPSCYMGS-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|