C20H20F4OS — CID 140909199
1,2,8,9-tetrafluoro-3-pentylsulfanyl-7-propyldibenzofuran (PubChem CID 140909199) has the molecular formula C20H20F4OS and a molecular weight of 384.44 g/mol. Its IUPAC name is 1,2,8,9-tetrafluoro-3-pentylsulfanyl-7-propyldibenzofuran.
| Compound Name | 1,2,8,9-tetrafluoro-3-pentylsulfanyl-7-propyldibenzofuran |
|---|---|
| PubChem CID | 140909199 |
| Molecular Formula | C20H20F4OS |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1,2,8,9-tetrafluoro-3-pentylsulfanyl-7-propyldibenzofuran |
| SMILES | CCCCCSc1cc2oc3cc(CCC)c(F)c(F)c3c2c(F)c1F |
| InChI | InChI=1S/C20H20F4OS/c1-3-5-6-8-26-14-10-13-16(20(24)18(14)22)15-12(25-13)9-11(7-4-2)17(21)19(15)23/h9-10H,3-8H2,1-2H3 |
| InChIKey | OYBWKTKUJLYJOO-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|