About 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate
7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate (PubChem CID 140909661) has the molecular formula C25H50O5
and a molecular weight of 430.67 g/mol. Its IUPAC name is 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate.
Molecular Properties
| Compound Name | 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate |
| PubChem CID | 140909661 |
| Molecular Formula | C25H50O5 |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.37 |
| IUPAC Name | 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate |
| SMILES | CCCCCCCCOCCOCCOCCCC(=O)OCCCCCCC(C)C |
| InChI | InChI=1S/C25H50O5/c1-4-5-6-7-9-12-17-27-20-22-29-23-21-28-18-14-16-25(26)30-19-13-10-8-11-15-24(2)3/h24H,4-23H2,1-3H3 |
| InChIKey | ONFYLDPDARHJLC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate?
The IUPAC name of 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate (CID 140909661) is 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate.
What is the SMILES notation for 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate?
The canonical SMILES for 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate is CCCCCCCCOCCOCCOCCCC(=O)OCCCCCCC(C)C.
What is the InChIKey of 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate?
The InChIKey is ONFYLDPDARHJLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H50O5/c1-4-5-6-7-9-12-17-27-20-22-29-23-21-28-18-14-16-25(26)30-19-13-10-8-11-15-24(2)3/h24H,4-23H2,1-3H3.
What are the key properties of 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate?
7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate has a molecular weight of 430.67 g/mol, XLogP of 6.33, 24 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyloctyl 4-[2-(2-octoxyethoxy)ethoxy]butanoate is sourced from PubChem (CID 140909661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).