C22H24N3O3+ — CID 140909739
1-[1-(2-hydroxyethyl)-3-phenyl-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-ium-5-yl]-2-phenoxyethanone (PubChem CID 140909739) has the molecular formula C22H24N3O3+ and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-[1-(2-hydroxyethyl)-3-phenyl-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-ium-5-yl]-2-phenoxyethanone.
| Compound Name | 1-[1-(2-hydroxyethyl)-3-phenyl-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-ium-5-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 140909739 |
| Molecular Formula | C22H24N3O3+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 1-[1-(2-hydroxyethyl)-3-phenyl-2,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-1-ium-5-yl]-2-phenoxyethanone |
| SMILES | O=C(COc1ccccc1)N1CCc2c(c(-c3ccccc3)[nH][n+]2CCO)C1 |
| InChI | InChI=1S/C22H23N3O3/c26-14-13-25-20-11-12-24(21(27)16-28-18-9-5-2-6-10-18)15-19(20)22(23-25)17-7-3-1-4-8-17/h1-10,26H,11-16H2/p+1 |
| InChIKey | XUEQNPBTWLACCO-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 69.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|