C22H19ClFN5O2 — CID 140910069
[(3R)-3-aminopyrrolidin-1-yl]-[5-chloro-2-(3-fluoro-4-isocyanophenyl)-1-(4-methoxyphenyl)imidazol-4-yl]methanone (PubChem CID 140910069) has the molecular formula C22H19ClFN5O2 and a molecular weight of 439.88 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[5-chloro-2-(3-fluoro-4-isocyanophenyl)-1-(4-methoxyphenyl)imidazol-4-yl]methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[5-chloro-2-(3-fluoro-4-isocyanophenyl)-1-(4-methoxyphenyl)imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 140910069 |
| Molecular Formula | C22H19ClFN5O2 |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[5-chloro-2-(3-fluoro-4-isocyanophenyl)-1-(4-methoxyphenyl)imidazol-4-yl]methanone |
| SMILES | [C-]#[N+]c1ccc(-c2nc(C(=O)N3CC[C@@H](N)C3)c(Cl)n2-c2ccc(OC)cc2)cc1F |
| InChI | InChI=1S/C22H19ClFN5O2/c1-26-18-8-3-13(11-17(18)24)21-27-19(22(30)28-10-9-14(25)12-28)20(23)29(21)15-4-6-16(31-2)7-5-15/h3-8,11,14H,9-10,12,25H2,2H3/t14-/m1/s1 |
| InChIKey | HCUKNGSHNPYOTO-CQSZACIVSA-N |
| XLogP | 4.06 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|