C18H20F2N4O — CID 140910573
11-[4-(2,3-difluoropropoxy)piperidin-1-yl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 140910573) has the molecular formula C18H20F2N4O and a molecular weight of 346.38 g/mol. Its IUPAC name is 11-[4-(2,3-difluoropropoxy)piperidin-1-yl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-[4-(2,3-difluoropropoxy)piperidin-1-yl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 140910573 |
| Molecular Formula | C18H20F2N4O |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 11-[4-(2,3-difluoropropoxy)piperidin-1-yl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | FCC(F)COC1CCN(c2ccc3c(n2)[nH]c2ccncc23)CC1 |
| InChI | InChI=1S/C18H20F2N4O/c19-9-12(20)11-25-13-4-7-24(8-5-13)17-2-1-14-15-10-21-6-3-16(15)22-18(14)23-17/h1-3,6,10,12-13H,4-5,7-9,11H2,(H,22,23) |
| InChIKey | JDQZFWQHRMZWTD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |