About ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate
ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate (PubChem CID 14091140) has the molecular formula C19H18ClNO4
and a molecular weight of 359.81 g/mol. Its IUPAC name is ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate.
Molecular Properties
| Compound Name | ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate |
| PubChem CID | 14091140 |
| Molecular Formula | C19H18ClNO4 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate |
| SMILES | CCOC(=O)C(CC)c1nc(-c2ccc(Cl)cc2)oc1-c1ccco1 |
| InChI | InChI=1S/C19H18ClNO4/c1-3-14(19(22)23-4-2)16-17(15-6-5-11-24-15)25-18(21-16)12-7-9-13(20)10-8-12/h5-11,14H,3-4H2,1-2H3 |
| InChIKey | VJFFJWITUZDZBQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate?
The IUPAC name of ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate (CID 14091140) is ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate.
What is the SMILES notation for ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate?
The canonical SMILES for ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate is CCOC(=O)C(CC)c1nc(-c2ccc(Cl)cc2)oc1-c1ccco1.
What is the InChIKey of ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate?
The InChIKey is VJFFJWITUZDZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClNO4/c1-3-14(19(22)23-4-2)16-17(15-6-5-11-24-15)25-18(21-16)12-7-9-13(20)10-8-12/h5-11,14H,3-4H2,1-2H3.
What are the key properties of ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate?
ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate has a molecular weight of 359.81 g/mol, XLogP of 5.31, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(4-chlorophenyl)-5-(furan-2-yl)-1,3-oxazol-4-yl]butanoate is sourced from PubChem (CID 14091140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).